CAS 17450-68-9
:6-Benzofurancarbonitrile
Description:
6-Benzofurancarbonitrile, identified by its CAS number 17450-68-9, is an organic compound characterized by the presence of a benzofuran moiety attached to a carbonitrile functional group. This compound typically exhibits a solid state at room temperature and is known for its aromatic properties due to the benzofuran structure, which contributes to its stability and potential reactivity. The carbonitrile group introduces a polar functional group, which can influence the compound's solubility in various solvents, often making it soluble in polar organic solvents. 6-Benzofurancarbonitrile may be utilized in various chemical syntheses and research applications, particularly in the development of pharmaceuticals and agrochemicals, owing to its unique structural features. Its reactivity can be attributed to the presence of the nitrile group, which can participate in nucleophilic addition reactions. As with many organic compounds, handling should be done with care, considering potential toxicity and environmental impact.
Formula:C9H5NO
InChI:InChI=1S/C9H5NO/c10-6-7-1-2-8-3-4-11-9(8)5-7/h1-5H
SMILES:c1cc2ccoc2cc1C#N
Synonyms:- Benzofuran-6-carbonitrile
- 6-Cyanobenzo[b]furan
- 1-Benzofuran-6-carbonitrile
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 4 products.
Benzofuran-6-carbonitrile
CAS:Benzofuran-6-carbonitrileFormula:C9H5NOPurity:>95%Molecular weight:143.141-Benzofuran-6-carbonitrile
CAS:1-Benzofuran-6-carbonitrile is a synthetic molecule that has been shown to have anti-inflammatory properties. It has been shown to inhibit the production of cytokines such as interleukin (IL)-1β, IL-6 and tumor necrosis factor alpha (TNFα) in vitro. 1-Benzofuran-6-carbonitrile has also been shown to inhibit the expression of ICAM-1 on lymphocytes, which may be due to its ability to bind with this receptor. This drug can also cross-couple with palladium and form a bond with an atom or molecule called an "antagonist" or "partner". The binding of these two molecules prevents their interaction, which is important for their biological function. Lifitegrast is one example of a drug that can act as an antagonist to 1BFC.
Formula:C9H5NOPurity:Min. 95%Molecular weight:143.14 g/mol



