CymitQuimica logo

CAS 174677-83-9

:

1,2-Cyclohexanediamine,N,N'-bis[[2-(diphenylphosphino)phenyl]methyl]-, (1S,2S)-

Description:
1,2-Cyclohexanediamine, N,N'-bis[[2-(diphenylphosphino)phenyl]methyl]-, (1S,2S)- is a chiral organic compound characterized by its complex structure, which includes a cyclohexanediamine backbone and two diphenylphosphino groups. This compound typically exhibits a high degree of steric hindrance due to the bulky diphenylphosphino substituents, which can influence its reactivity and interactions in coordination chemistry. The presence of the chiral centers in the cyclohexanediamine moiety allows for potential applications in asymmetric synthesis and catalysis. Additionally, the phosphine groups can act as ligands, forming stable complexes with transition metals, which are valuable in various catalytic processes. The compound is likely to be a solid at room temperature and may exhibit solubility in organic solvents. Its specific properties, such as melting point, boiling point, and solubility, would depend on the purity and specific conditions of the environment. Overall, this compound is of interest in the fields of organometallic chemistry and catalysis due to its unique structural features and potential applications.
Formula:C44H44N2P2
InChI:InChI=1S/C44H44N2P2/c45-41-29-15-16-30-42(41)46(33-35-19-13-17-31-43(35)47(37-21-5-1-6-22-37)38-23-7-2-8-24-38)34-36-20-14-18-32-44(36)48(39-25-9-3-10-26-39)40-27-11-4-12-28-40/h1-14,17-28,31-32,41-42H,15-16,29-30,33-34,45H2/t41-,42-/m0/s1
InChI key:GEZITKLHMKZYMH-COCZKOEFSA-N
SMILES:C1CC[C@@H]([C@H](C1)N)N(CC2=CC=CC=C2P(C3=CC=CC=C3)C4=CC=CC=C4)CC5=CC=CC=C5P(C6=CC=CC=C6)C7=CC=CC=C7
Synonyms:
  • (S,S)-1,2-Bis[[[2-(Diphenylphosphino)Phenyl]Methyl]Amino]Cyclohexane
Found 5 products.