CymitQuimica logo

CAS 175136-36-4

:

Ethanone, 1-(7-bromo-2,3-dihydro-1,4-benzodioxin-6-yl)-2-phenyl-

Description:
Ethanone, 1-(7-bromo-2,3-dihydro-1,4-benzodioxin-6-yl)-2-phenyl- is a chemical compound characterized by its complex structure, which includes a benzodioxin moiety and a phenyl group. The presence of the bromine atom indicates that it is a halogenated compound, which can influence its reactivity and biological activity. This compound likely exhibits properties typical of both aromatic and aliphatic systems, including potential hydrophobicity due to the aromatic rings. The benzodioxin structure may contribute to its stability and potential for forming hydrogen bonds. Additionally, the presence of the ethanone functional group suggests that it may participate in various chemical reactions, such as nucleophilic additions or substitutions. This compound may have applications in medicinal chemistry or materials science, although specific biological activities or uses would depend on further research. As with many organic compounds, safety and handling precautions should be observed due to the presence of bromine and the potential for toxicity or environmental impact.
Formula:C16H13BrO3
InChI:InChI=1S/C16H13BrO3/c17-13-10-16-15(19-6-7-20-16)9-12(13)14(18)8-11-4-2-1-3-5-11/h1-5,9-10H,6-8H2
InChI key:InChIKey=JKMNAXMPRIKLNS-UHFFFAOYSA-N
SMILES:C(CC1=CC=CC=C1)(=O)C=2C=C3C(=CC2Br)OCCO3
Synonyms:
  • 1-(7-Bromo-2,3-dihydro-1,4-benzodioxin-6-yl)-2-phenylethan-1-one
  • Ethanone, 1-(7-bromo-2,3-dihydro-1,4-benzodioxin-6-yl)-2-phenyl-
  • 1-(6-Bromo-2,3-dihydro-1,4-benzodioxin-7-yl)-2-phenylethanone
  • 1-(7-Bromo-2,3-dihydro-benzo[1,4]dioxin-6-yl)-2-phenyl-ethanone
Found 2 products.