CymitQuimica logo

CAS 175136-39-7

:

(7-BROMO-2,3-DIHYDRO-1,4-BENZODIOXIN-6-YL)(4-CHLOROPHENYL)METHANONE

Description:
(7-Bromo-2,3-dihydro-1,4-benzodioxin-6-yl)(4-chlorophenyl)methanone, with the CAS number 175136-39-7, is a synthetic organic compound characterized by its complex structure, which includes a benzodioxin moiety and a chlorophenyl group. The presence of the bromine atom and the chlorophenyl substituent suggests potential applications in medicinal chemistry, particularly in the development of pharmaceuticals. This compound may exhibit unique biological activities due to its structural features, which can influence its interaction with biological targets. The benzodioxin core is known for its stability and ability to participate in various chemical reactions, while the halogen substituents can enhance lipophilicity and modulate pharmacokinetic properties. As with many synthetic compounds, safety and handling precautions are essential, as they may pose risks such as toxicity or environmental hazards. Further studies, including biological assays and toxicological evaluations, would be necessary to fully understand its properties and potential applications in research or industry.
Formula:C15H10BrClO3
InChI:InChI=1/C15H10BrClO3/c16-12-8-14-13(19-5-6-20-14)7-11(12)15(18)9-1-3-10(17)4-2-9/h1-4,7-8H,5-6H2
InChI key:CYBXDLDZMRBBBM-UHFFFAOYSA-N
SMILES:c1cc(ccc1C(=O)c1cc2c(cc1Br)OCCO2)Cl
Synonyms:
  • (7-Bromo-2,3-dihydro-1,4-benzodioxine-6-yl)-(4-chlorophenyl)methanone
  • 2-(4-Chlorobenzoyl)-4,5-Ethylenedioxybromobenzene
Found 2 products.