CAS 17515-77-4
:2-(bromomethyl)-5-(trifluoromethyl)furan
Description:
2-(Bromomethyl)-5-(trifluoromethyl)furan is a chemical compound characterized by its furan ring, which is a five-membered aromatic heterocycle containing one oxygen atom. The presence of a bromomethyl group at the 2-position and a trifluoromethyl group at the 5-position significantly influences its chemical reactivity and physical properties. This compound is typically a colorless to pale yellow liquid or solid, depending on its purity and specific conditions. It exhibits notable polar characteristics due to the electronegative trifluoromethyl group, which can enhance its reactivity in nucleophilic substitution reactions. The bromomethyl group serves as a versatile functional handle for further chemical modifications. Additionally, the compound may exhibit biological activity, making it of interest in medicinal chemistry and material science. Its CAS number, 17515-77-4, allows for easy identification in chemical databases. Safety precautions should be taken when handling this compound, as it may pose health risks due to the presence of bromine and fluorine atoms.
Formula:C6H4BrF3O
InChI:InChI=1/C14H15F6NO4S2/c1-25-12(22)11(3-4-26-2)21-27(23,24)10-6-8(13(15,16)17)5-9(7-10)14(18,19)20/h5-7,11,21H,3-4H2,1-2H3
SMILES:COC(=O)C(CCSC)NS(=O)(=O)c1cc(cc(c1)C(F)(F)F)C(F)(F)F
Synonyms:- methyl N-{[3,5-bis(trifluoromethyl)phenyl]sulfonyl}methioninate
- 2-Bromomethyl-5-Trifluoromethylfurane
- 2-(Bromomethyl)-5-(trifluoromethyl)furan97%
- 2-(BROMOMETHYL)-5-(TRIFLUOROMETHYL)FURAN
- Furan,2-(broMoMethyl)-5-(trifluoroMethyl)-
- 2-(Bromomethyl)-5-(trifluoromethyl)furane
- 2-(Bromomethyl)-5-(trifluoromethyl)furan 97%
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 6 products.
2-(Bromomethyl)-5-(trifluoromethyl)furan
CAS:Formula:C6H4BrF3OPurity:>97.0%(GC)Color and Shape:Colorless to Light yellow to Light orange clear liquidMolecular weight:229.00Furan, 2-(bromomethyl)-5-(trifluoromethyl)-
CAS:Formula:C6H4BrF3OPurity:98%Color and Shape:LiquidMolecular weight:228.99462-(Bromomethyl)-5-(trifluoromethyl)furan
CAS:2-(Bromomethyl)-5-(trifluoromethyl)furanFormula:C6H4BrF3OPurity:95%Color and Shape:Pale yellow LiquidMolecular weight:228.994562-(Bromomethyl)-5-(trifluoromethyl)furan
CAS:2-(Bromomethyl)-5-(trifluoromethyl)furanFormula:C6H4BrF3OPurity:95%Molecular weight:228.992-(Bromomethyl)-5-(trifluoromethyl)furan
CAS:Formula:C6H4BrF3OPurity:98%Color and Shape:Liquid, No data available.Molecular weight:228.9962-(Bromomethyl)-5-(trifluoromethyl)furan
CAS:Controlled ProductApplications 2-(Bromomethyl)-5-(trifluoromethyl)furan is an intermediate used to prepare tertiary sulfonamides as liver X receptor antagonists. It is also used to synthesize hydantoin based inhibitors of MMP13 with potential use in osteoarthritis.
References Zuercher, W., et al.: J. Med. Chem., 53, 3412 (2010); De Savi, C., et al.: Bioorg. Med. Chem. Lett., 23, 4705 (2013)Formula:C6H4BrF3OColor and Shape:NeatMolecular weight:228.99





