CymitQuimica logo

CAS 175202-69-4

:

6,7-Dihydro-3-(methylsulfonyl)benzo[c]thiophene-1-carboxylic acid

Description:
6,7-Dihydro-3-(methylsulfonyl)benzo[c]thiophene-1-carboxylic acid is a chemical compound characterized by its unique structure, which includes a benzo[c]thiophene core fused with a carboxylic acid and a methylsulfonyl group. This compound typically exhibits properties associated with both aromatic and heterocyclic compounds, including potential biological activity due to the presence of the thiophene ring, which can influence its reactivity and solubility. The methylsulfonyl group may enhance its polar characteristics, affecting its interaction with biological systems and solvents. As a carboxylic acid, it can participate in acid-base reactions and form salts or esters. The compound's molecular structure suggests potential applications in pharmaceuticals or agrochemicals, where thiophene derivatives are often explored for their therapeutic properties. Additionally, its specific stereochemistry and functional groups may contribute to its overall stability and reactivity, making it a subject of interest in synthetic organic chemistry and medicinal chemistry research.
Formula:C10H10O4S2
InChI:InChI=1S/C10H10O4S2/c1-16(13,14)10-7-5-3-2-4-6(7)8(15-10)9(11)12/h3,5H,2,4H2,1H3,(H,11,12)
InChI key:InChIKey=BNAQIWIFPNXUHJ-UHFFFAOYSA-N
SMILES:S(C)(=O)(=O)C1=C2C(=C(C(O)=O)S1)CCC=C2
Synonyms:
  • 3-Methanesulfonyl-6,7-dihydro-2-benzothiophene-1-carboxylic acid
  • 6,7-Dihydro-3-(methylsulfonyl)benzo[c]thiophene-1-carboxylic acid
  • Benzo[c]thiophene-1-carboxylic acid, 6,7-dihydro-3-(methylsulfonyl)-
  • 3-Methylsulfonyl-6,7-dihydro-2-benzothiophene-1-carboxylic acid
Found 2 products.