CymitQuimica logo

CAS 175204-39-4

:

4-TERT-BUTYLBENZAMIDOXIME

Description:
4-Tert-Butylbenzamidoxime is an organic compound characterized by its amido and oxime functional groups. It features a tert-butyl group attached to a benzene ring, which enhances its lipophilicity and steric bulk. The presence of the oxime functional group (-C=N-OH) indicates that it can participate in various chemical reactions, including condensation and rearrangement reactions. This compound is typically used in organic synthesis and may serve as an intermediate in the preparation of other chemical entities. Its structure suggests potential applications in pharmaceuticals or agrochemicals, where modifications to the benzene ring can lead to diverse biological activities. Additionally, the compound's stability and reactivity can be influenced by the steric hindrance provided by the tert-butyl group, making it an interesting subject for studies in reaction mechanisms and material science. Safety data should be consulted for handling and storage, as with all chemical substances, to ensure proper laboratory practices are followed.
Formula:C11H16N2O
InChI:InChI=1/C11H16N2O/c1-11(2,3)9-6-4-8(5-7-9)10(12)13-14/h4-7,14H,1-3H3,(H2,12,13)
InChI key:QUCZBZUPJKDIRP-UHFFFAOYSA-N
SMILES:CC(C)(C)c1ccc(cc1)C(=NO)N
Synonyms:
  • 4-Tert-Butyl-N-Hydroxy-Benzamidine
  • 4-(Tert-Butyl)-N'-Hydroxybenzenecarboximidamide
  • Benzenecarboximidamide, 4-(1,1-dimethylethyl)-N-hydroxy- (9CI)
Found 5 products.