CAS 175278-22-5
:4-Amino-3-(trifluoromethoxy)benzoic acid
Description:
4-Amino-3-(trifluoromethoxy)benzoic acid is an organic compound characterized by the presence of an amino group and a trifluoromethoxy group attached to a benzoic acid structure. Its molecular formula typically includes carbon, hydrogen, nitrogen, oxygen, and fluorine atoms, reflecting its functional groups. The amino group (-NH2) contributes to its basicity and potential for forming hydrogen bonds, while the trifluoromethoxy group (-O-CF3) enhances its lipophilicity and can influence its reactivity and solubility in organic solvents. This compound may exhibit interesting biological activity, making it of interest in pharmaceutical research. Its properties, such as melting point, boiling point, and solubility, can vary based on the specific conditions and purity of the sample. Additionally, the presence of fluorine atoms often imparts unique electronic properties, which can affect the compound's interactions with biological targets. Overall, 4-Amino-3-(trifluoromethoxy)benzoic acid is a versatile compound with potential applications in medicinal chemistry and material science.
Formula:C8H6F3NO3
InChI:InChI=1S/C8H6F3NO3/c9-8(10,11)15-6-3-4(7(13)14)1-2-5(6)12/h1-3H,12H2,(H,13,14)
InChI key:InChIKey=IXJFWBNYFTWBOR-UHFFFAOYSA-N
SMILES:O(C(F)(F)F)C1=CC(C(O)=O)=CC=C1N
Synonyms:- 4-Amino-3-trifluoromethoxybenzoic acid
- Benzoic acid, 4-amino-3-(trifluoromethoxy)-
- 4-Amino-3-(trifluoromethoxy)benzoic acid
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 5 products.
4-Amino-3-(trifluoromethoxy)benzoic acid, 98%
CAS:This Thermo Scientific Chemicals brand product was originally part of the Alfa Aesar product portfolio. Some documentation and label information may refer to the legacy brand. The original Alfa Aesar product / item code or SKU reference has not changed as a part of the brand transition to Thermo SciFormula:C8H6F3NO3Purity:98%Color and Shape:Cream, PowderMolecular weight:221.144-Amino-3-(trifluoromethoxy)benzoic acid
CAS:4-Amino-3-(trifluoromethoxy)benzoic acidFormula:C8H6F3NO3Purity:97%Color and Shape:SolidMolecular weight:221.13334Benzoic acid, 4-amino-3-(trifluoromethoxy)-
CAS:Formula:C8H6F3NO3Purity:97%Color and Shape:SolidMolecular weight:221.13334-Amino-3-(trifluoromethoxy)benzoic acid
CAS:Formula:C8H6F3NO3Purity:97%Color and Shape:SolidMolecular weight:221.1354-Amino-3-(trifluoromethoxy)benzoic acid
CAS:Please enquire for more information about 4-Amino-3-(trifluoromethoxy)benzoic acid including the price, delivery time and more detailed product information at the technical inquiry form on this pageFormula:C8H6F3NO3Purity:Min. 95%Molecular weight:221.13 g/mol




