CymitQuimica logo

CAS 175278-50-9

:

3-{4-[(4-methylphenyl)thio]-3-nitrophenyl}acrylic acid

Description:
3-{4-[(4-methylphenyl)thio]-3-nitrophenyl}acrylic acid, with the CAS number 175278-50-9, is an organic compound characterized by its unique structural features. It contains an acrylic acid moiety, which is a common functional group known for its reactivity and ability to participate in polymerization processes. The presence of a nitrophenyl group introduces electron-withdrawing characteristics, enhancing the compound's potential for various chemical reactions. Additionally, the thioether linkage with a 4-methylphenyl group contributes to its hydrophobic properties, which can influence solubility and interaction with biological systems. This compound may exhibit interesting biological activities due to its structural complexity, making it a candidate for research in medicinal chemistry and materials science. Its synthesis and application could be explored in the development of novel pharmaceuticals or as intermediates in organic synthesis. Overall, the combination of functional groups in this compound suggests a versatile chemical behavior, warranting further investigation into its properties and potential uses.
Formula:C16H13NO4S
InChI:InChI=1/C16H13NO4S/c1-11-2-6-13(7-3-11)22-15-8-4-12(5-9-16(18)19)10-14(15)17(20)21/h2-10H,1H3,(H,18,19)/b9-5+
InChI key:ZEEXVYNJSAWEML-WEVVVXLNSA-N
SMILES:CC1=CC=C(C=C1)SC2=C(C=C(C=C2)/C=C/C(=O)O)[N+](=O)[O-]
Synonyms:
  • (2E)-3-{4-[(4-methylphenyl)sulfanyl]-3-nitrophenyl}prop-2-enoic acid
  • 3-[4-[(4-Methylphenyl)thio]-3-nitrophenyl]acrylic acid
Found 2 products.