CAS 175340-20-2
:(3aS)-2,3,3a,4-tetrahydro-1H-pyrrolo[2,1-c][1,2,4]benzothiadiazine 5,5-dioxide
Description:
(3aS)-2,3,3a,4-tetrahydro-1H-pyrrolo[2,1-c][1,2,4]benzothiadiazine 5,5-dioxide is a heterocyclic compound characterized by its complex bicyclic structure, which incorporates both a pyrrole and a benzothiadiazine moiety. This compound features a sulfur atom and two nitrogen atoms within its structure, contributing to its unique chemical properties. The presence of the 5,5-dioxide functional group indicates that it has two double-bonded oxygen atoms attached to the sulfur, enhancing its reactivity and potential for forming various derivatives. The stereochemistry, indicated by the (3aS) designation, suggests specific spatial arrangements of atoms that can influence the compound's biological activity and interactions. Such compounds are often of interest in medicinal chemistry due to their potential pharmacological properties, including anti-inflammatory or antitumor activities. The compound's solubility, stability, and reactivity can vary significantly based on its structural features, making it a subject of interest for further research and application in drug development.
Formula:C10H12N2O2S
InChI:InChI=1S/C10H12N2O2S/c13-15(14)9-5-2-1-4-8(9)12-7-3-6-10(12)11-15/h1-2,4-5,10-11H,3,6-7H2/t10-/m1/s1
InChI key:InChIKey=MNTIJYGEITVWHU-SNVBAGLBSA-N
SMILES:O=S1(=O)C=2C(N3[C@@](N1)(CCC3)[H])=CC=CC2
Synonyms:- S 18986
- S 18986-1
- 1H-Pyrrolo[2,1-c][1,2,4]benzothiadiazine, 2,3,3a,4-tetrahydro-, 5,5-dioxide, (S)-
- (3aS)-2,3,3a,4-tetrahydro-1H-pyrrolo[2,1-c][1,2,4]benzothiadiazine 5,5-dioxide
- 1H-Pyrrolo[2,1-c][1,2,4]benzothiadiazine, 2,3,3a,4-tetrahydro-, 5,5-dioxide, (3aS)-
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 4 products.
(3AS)-2,3,3a,4-tetrahydro-1H-pyrrolo[2,1-c][1,2,4]benzothiadiazine 5,5-dioxide
CAS:Formula:C10H12N2O2SPurity:98%Molecular weight:224.2795S 18986
CAS:S 18986 is a novel molecule that binds to the glutamate receptor. It has been shown to protect neurons against glutamate-induced cell death in vitro and in vivo, as well as reversing memory deficits in aged mice. S 18986 also increases the production of neurotrophic factors and enhances neuronal function. The pharmacokinetics of S 18986 have been studied using a population modeling approach. This approach provides an asymmetric synthesis route for the preparation of this compound. S 18986 has also been shown to increase locomotor activity, which may be due to its ability to potentiate GABAergic transmission.END>
Formula:C10H12N2O2SPurity:Min. 95%Molecular weight:224.28 g/molS 18986
CAS:S 18986 is a selective, orally active, brain penetrant positive allosteric modulator of AMPA-type receptors, showcasing cognitive-enhancing properties inFormula:C10H12N2O2SPurity:99.64%Color and Shape:Yellow SolidMolecular weight:224.28




