CymitQuimica logo

CAS 1755-04-0

:

Bicyclo[3.1.0]hexan-3-one

Description:
Bicyclo[3.1.0]hexan-3-one, with the CAS number 1755-04-0, is a bicyclic organic compound characterized by its unique structural framework, which consists of a six-membered ring containing two fused cyclopropane rings and a ketone functional group at the 3-position. This compound exhibits a distinctive three-dimensional arrangement that influences its reactivity and physical properties. Typically, bicyclic compounds like this one can display interesting stereochemistry and conformational dynamics due to the constraints imposed by their ring structures. Bicyclo[3.1.0]hexan-3-one is generally a colorless to pale yellow liquid or solid, depending on temperature and purity, and may have a characteristic odor. Its reactivity is influenced by the presence of the carbonyl group, making it susceptible to nucleophilic attacks and other chemical transformations. Additionally, this compound may serve as a useful intermediate in organic synthesis, particularly in the development of more complex molecules in pharmaceuticals and agrochemicals. Safety data should be consulted for handling and storage, as with all chemical substances.
Formula:C6H8O
InChI:InChI=1S/C6H8O/c7-6-2-4-1-5(4)3-6/h4-5H,1-3H2
InChI key:WQQZKEFUOHKGII-UHFFFAOYSA-N
SMILES:C1C2C1CC(=O)C2
Found 4 products.