CAS 17576-63-5
:3-fluoro-4-nitro-1-oxido-quinoline
Description:
3-Fluoro-4-nitro-1-oxido-quinoline, identified by its CAS number 17576-63-5, is a heterocyclic organic compound that features a quinoline structure, which is a bicyclic compound composed of a benzene ring fused to a pyridine ring. The presence of a fluoro group at the 3-position and a nitro group at the 4-position contributes to its unique chemical properties and reactivity. The "1-oxido" designation indicates the presence of an oxygen atom that is part of a functional group, which can influence the compound's electronic characteristics and potential interactions with other molecules. This compound may exhibit biological activity, making it of interest in medicinal chemistry and pharmacology. Its solubility, stability, and reactivity can vary based on environmental conditions and the presence of other chemical species. Overall, 3-fluoro-4-nitro-1-oxido-quinoline represents a class of compounds that can be explored for various applications, including as potential pharmaceuticals or in material science.
Formula:C9H5FN2O3
InChI:InChI=1/C9H5FN2O3/c10-7-5-11(13)8-4-2-1-3-6(8)9(7)12(14)15/h1-5H
InChI key:NMFUNZZDIKAODM-UHFFFAOYSA-N
SMILES:c1ccc2c(c1)c(c(cn2=O)F)N(=O)=O
Synonyms:- Quinoline, 3-fluoro-4-nitro-, 1-oxide
- 3-Fluoro-4-nitroquinoline 1-oxide
- Brn 1315880
Filter by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
- Lower prices
- Higher prices
- Lower purities
- Higher purities
- Faster estimated delivery
