CAS 17583-10-7
:2-amino-5,6-dihydro-1,3-benzothiazol-7(4H)-one
Description:
2-amino-5,6-dihydro-1,3-benzothiazol-7(4H)-one, with the CAS number 17583-10-7, is a heterocyclic compound featuring a benzothiazole core. This compound is characterized by the presence of an amino group and a carbonyl group, contributing to its reactivity and potential biological activity. It typically appears as a solid at room temperature and is soluble in polar solvents, which enhances its utility in various chemical reactions. The benzothiazole structure imparts unique electronic properties, making it a candidate for applications in pharmaceuticals, agrochemicals, and materials science. Its derivatives may exhibit antimicrobial, anti-inflammatory, or anticancer properties, reflecting the significance of the benzothiazole moiety in medicinal chemistry. Additionally, the compound's stability and reactivity can be influenced by the presence of substituents on the benzothiazole ring, which can modulate its interactions with biological targets. Overall, 2-amino-5,6-dihydro-1,3-benzothiazol-7(4H)-one is an important compound in the study of organic synthesis and drug development.
Formula:C7H8N2OS
InChI:InChI=1/C7H8N2OS/c8-7-9-4-2-1-3-5(10)6(4)11-7/h1-3H2,(H2,8,9)
SMILES:C1Cc2c(C(=O)C1)sc(=N)[nH]2
Synonyms:- 7(4H)-Benzothiazolone, 2-amino-5,6-dihydro-
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 6 products.
7(4H)-Benzothiazolone, 2-amino-5,6-dihydro-
CAS:Formula:C7H8N2OSPurity:98%Color and Shape:SolidMolecular weight:168.2162Ref: IN-DA002189
1kgTo inquire1g24.00€5g47.00€10g63.00€25g115.00€50g155.00€100g184.00€250g364.00€500g548.00€2-Amino-5,6-Dihydro-1,3-Benzothiazol-7(4H)-One
CAS:2-Amino-5,6-Dihydro-1,3-Benzothiazol-7(4H)-OneFormula:C7H8N2OSPurity:97%Color and Shape:SolidMolecular weight:168.222-Amino-5,6-dihydro-1,3-benzothiazol-7(4H)-one
CAS:Formula:C7H8N2OSPurity:95%Color and Shape:SolidMolecular weight:168.212-Amino-5,6-dihydrobenzo[d]thiazol-7(4H)-one
CAS:2-Amino-5,6-dihydrobenzo[d]thiazol-7(4H)-oneFormula:C7H8N2OSPurity:98%Molecular weight:168.222-Amino-5,6-dihydro-4h-benzothiazol-7-one
CAS:Controlled ProductApplications 2-Amino-5,6-dihydro-4h-benzothiazol-7-one
Formula:C7H8N2OSColor and Shape:NeatMolecular weight:168.222-Amino-5,6-dihydro-4H-benzothiazol-7-one
CAS:2-Amino-5,6-dihydro-4H-benzothiazol-7-one is a thiourea that is used as a reactant in the synthesis of brominated compounds. It reacts with ethanol to form 2,5,6-triaminopyrimidine and hydrogen bromide. This reaction occurs in the presence of acid such as hydrochloric acid or acetic acid. The reflux reaction is commonly conducted at elevated temperatures and pressures.
Purity:Min. 95%





