CAS 1759-68-8
:N-Cyclohexylbenzamide
Description:
N-Cyclohexylbenzamide is an organic compound characterized by its amide functional group, where a cyclohexyl group is attached to the nitrogen atom of the benzamide structure. This compound typically appears as a white to off-white solid and is known for its relatively low solubility in water, while being more soluble in organic solvents such as ethanol and acetone. N-Cyclohexylbenzamide exhibits a melting point that is influenced by its molecular structure and intermolecular interactions. It is often utilized in various chemical applications, including as a building block in organic synthesis and in the development of pharmaceuticals. The presence of both the cyclohexyl and benzene rings contributes to its hydrophobic characteristics, which can affect its reactivity and interactions with biological systems. Additionally, this compound may exhibit specific biological activities, making it of interest in medicinal chemistry. Proper handling and safety measures should be observed, as with any chemical substance, to mitigate potential hazards associated with its use.
Formula:C13H17NO
InChI:InChI=1S/C13H17NO/c15-13(11-7-3-1-4-8-11)14-12-9-5-2-6-10-12/h1,3-4,7-8,12H,2,5-6,9-10H2,(H,14,15)
InChI key:InChIKey=KQJYDHWNYPRIRY-UHFFFAOYSA-N
SMILES:C(NC1CCCCC1)(=O)C2=CC=CC=C2
Synonyms:- 1′,2′,3′,4′,5′,6′-Hexahydrobenzanilide
- N-Benzoylcyclohexylamine
- N-Hexamethylenebenzamide
- NSC 4632
- benzamide, N-cyclohexyl-
- benzenecarboximidic acid, N-cyclohexyl-
- N-Cyclohexylbenzamide
- N-Cyclohexylbenzamide
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 5 products.
N-Cyclohexylbenzamide
CAS:N-Cyclohexylbenzamide is a cross-coupling reaction that is used in organic synthesis. It is an efficient method for the synthesis of organometallic compounds and pharmaceuticals, including drugs with high bioavailability. N-Cyclohexylbenzamide has been shown to be effective against intestinal bacteria such as Salmonella enterica and Helicobacter pylori. This drug has also been detected in humans, where it can be found at low concentrations in urine. The compound is metabolized by hydrolysis of the amide group to yield benzoic acid and cyclohexanol. The mechanism of action of N-Cyclohexylbenzamide is not fully understood, but it has been postulated that it inhibits the formation of reactive oxygen species (ROS) by preventing the activity of NADPH oxidase, which leads to oxidative stress and cell death.Formula:C13H17NOPurity:Min. 95%Molecular weight:203.28 g/mol




