CymitQuimica logo

CAS 17616-24-9

:

ETHYL-D5-AMINE

Description:
Ethyl-D5-amine, with the CAS number 17616-24-9, is a deuterated derivative of ethylamine, where five hydrogen atoms are replaced by deuterium, a stable isotope of hydrogen. This compound is characterized by its amine functional group, which imparts basic properties and allows it to participate in various chemical reactions, such as nucleophilic substitutions and condensation reactions. Ethyl-D5-amine is typically a colorless liquid at room temperature and is soluble in water and organic solvents, making it versatile for use in chemical synthesis and research applications. The presence of deuterium enhances its utility in studies involving isotopic labeling, particularly in NMR spectroscopy and kinetic isotope effects. Additionally, due to its structural similarity to ethylamine, it may exhibit similar reactivity patterns, although the kinetic and thermodynamic properties can differ due to the isotopic substitution. Safety data should be consulted for handling and storage, as with any chemical substance, to ensure proper precautions are taken.
Formula:C2H2D5N
InChI:InChI=1/C2H7N/c1-2-3/h2-3H2,1H3/i1D3,2D2
InChI key:QUSNBJAOOMFDIB-ZBJDZAJPSA-N
SMILES:C(C(N)([2H])[2H])([2H])([2H])[2H]
Synonyms:
  • Ethylamine (D5)
  • Ethyl-D5-Amine (Gas) 99%
  • Ethan-d5-amine
  • (~2~H_5_)ethanamine
Found 2 products.