CymitQuimica logo

CAS 17635-45-9

:

4-(1H-pyrazol-1-yl)aniline

Description:
4-(1H-pyrazol-1-yl)aniline, with the CAS number 17635-45-9, is an organic compound characterized by the presence of both an aniline and a pyrazole functional group. It features a pyrazole ring, which is a five-membered heterocyclic structure containing two nitrogen atoms, bonded to a phenyl group through an amino (-NH2) linkage. This compound typically exhibits properties such as moderate solubility in polar solvents due to the presence of the amino group, which can engage in hydrogen bonding. It may also display biological activity, making it of interest in medicinal chemistry and drug development. The compound's structure allows for potential interactions with various biological targets, and it may serve as a precursor or intermediate in the synthesis of more complex molecules. Additionally, its stability and reactivity can be influenced by the electronic effects of the substituents on the aromatic ring and the pyrazole moiety. Overall, 4-(1H-pyrazol-1-yl)aniline is a versatile compound with applications in research and industry.
Formula:C9H9N3
InChI:InChI=1/C9H9N3/c10-8-2-4-9(5-3-8)12-7-1-6-11-12/h1-7H,10H2
InChI key:CSFIQHZIFKIQNO-UHFFFAOYSA-N
SMILES:c1cnn(c1)c1ccc(cc1)N
Synonyms:
  • 1-(4-Aminophenyl)pyrazole
Found 4 products.