CymitQuimica logo

CAS 176379-08-1

:

Benzamide, 3,4,5-tris(acetyloxy)-N-[6-(dimethylamino)-1-(4-fluorophenyl)-1,2,3,4-tetrahydro-3-methyl-2,4-dioxo-5-pyrimidinyl]-

Description:
Benzamide, 3,4,5-tris(acetyloxy)-N-[6-(dimethylamino)-1-(4-fluorophenyl)-1,2,3,4-tetrahydro-3-methyl-2,4-dioxo-5-pyrimidinyl]- is a complex organic compound characterized by its benzamide core structure, which is modified with multiple acetyloxy groups and a dimethylamino-substituted pyrimidine moiety. This compound exhibits properties typical of amides, including potential solubility in polar solvents and the ability to participate in hydrogen bonding due to the presence of the amide functional group. The presence of the acetyloxy groups may enhance its lipophilicity and influence its biological activity. The fluorophenyl group can impart unique electronic properties, potentially affecting the compound's reactivity and interaction with biological targets. Additionally, the tetrahydro-pyrimidine structure contributes to the compound's overall stability and may play a role in its pharmacological profile. Overall, this compound's intricate structure suggests potential applications in medicinal chemistry, particularly in the development of therapeutic agents.
Formula:C26H25FN4O9
InChI:InChI=1S/C26H25FN4O9/c1-13(32)38-19-11-16(12-20(39-14(2)33)22(19)40-15(3)34)23(35)28-21-24(29(4)5)31(26(37)30(6)25(21)36)18-9-7-17(27)8-10-18/h7-12H,1-6H3,(H,28,35)
InChI key:WNZWSPNVPOMFNN-UHFFFAOYSA-N
SMILES:CC(=O)OC1=CC(=CC(=C1OC(=O)C)OC(=O)C)C(=O)NC2=C(N(C(=O)N(C2=O)C)C3=CC=C(C=C3)F)N(C)C
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.