CAS 1765-48-6
:ω-Hydroperfluoroundecanoic acid
Description:
ω-Hydroperfluoroundecanoic acid, with the CAS number 1765-48-6, is a perfluorinated carboxylic acid characterized by a long carbon chain and the presence of a hydroperoxide functional group. This compound features a fully fluorinated carbon backbone, which imparts unique properties such as high thermal stability, low surface tension, and resistance to chemical degradation. The hydroperoxide group introduces reactivity that can be exploited in various chemical reactions. ω-Hydroperfluoroundecanoic acid is typically used in specialized applications, including surfactants, emulsifiers, and in the synthesis of other fluorinated compounds. Its environmental persistence and potential bioaccumulation raise concerns, as with many perfluorinated substances, leading to increased scrutiny and regulation. The compound's unique properties make it valuable in industrial applications, but its environmental impact necessitates careful handling and consideration in usage. Overall, ω-Hydroperfluoroundecanoic acid exemplifies the dual nature of perfluorinated compounds, offering utility while posing environmental challenges.
Formula:C11H2F20O2
InChI:InChI=1S/C11H2F20O2/c12-1(13)3(14,15)5(18,19)7(22,23)9(26,27)11(30,31)10(28,29)8(24,25)6(20,21)4(16,17)2(32)33/h1H,(H,32,33)
InChI key:InChIKey=MMYNPHSPRPZSSN-UHFFFAOYSA-N
SMILES:C(C(C(C(C(C(F)F)(F)F)(F)F)(F)F)(F)F)(C(C(C(C(C(O)=O)(F)F)(F)F)(F)F)(F)F)(F)F
Synonyms:- 11-H-Eicosafluoroundecanoic acid
- 11H-Perfluoroundecanoic acid
- 2,2,3,3,4,4,5,5,6,6,7,7,8,8,9,9,10,10,11,11-Eicosafluoroundecanoic acid
- 2,2,3,3,4,4,5,5,6,6,7,7,8,8,9,9,10,10,11,11-Icosafluoroundecanoic Acid
- Eicosafluoroundecanoicacid
- Undecanoic acid, 2,2,3,3,4,4,5,5,6,6,7,7,8,8,9,9,10,10,11,11-eicosafluoro-
- ω-Hydroperfluoroundecanoic acid
- ω-Monohydroperfluoroundecanoic acid
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 5 products.
Undecanoic acid, 2,2,3,3,4,4,5,5,6,6,7,7,8,8,9,9,10,10,11,11-eicosafluoro-
CAS:Formula:C11H2F20O2Purity:94%Color and Shape:SolidMolecular weight:546.100411-H-Eicosafluoroundecanoic acid
CAS:Controlled ProductFormula:C11H2F20O2Color and Shape:Off-WhiteMolecular weight:546.100411H-Perfluoroundecanoic acid
CAS:11H-Perfluoroundecanoic acidFormula:C11H2F20O2Purity:97%Color and Shape:White SolidMolecular weight:546.100442,2,3,3,4,4,5,5,6,6,7,7,8,8,9,9,10,10,11,11-Eicosafluoro-Undecanoic acid
CAS:The perfluoro-acid is a synthetic fatty acid that is used in the production of industrial chemicals. It is also used as a dietary supplement to increase the intake of long chain polyunsaturated fatty acids. The perfluoro-acid has been shown to inhibit uptake and reaction products with caco-2 cells, which may be due to its ability to interfere with the transport of organic anions by transporter proteins. This compound has also been shown to have anticancer properties, which may be due to its ability to inhibit the synthesis of DNA and RNA.
Formula:C11H2F20O2Purity:Min. 95%Color and Shape:PowderMolecular weight:546.1 g/mol




