CymitQuimica logo

CAS 17673-62-0

:

LINOLEYL LINOLEATE

Description:
Linoleyl linoleate is an ester derived from linoleic acid, a polyunsaturated fatty acid, and is characterized by its long hydrocarbon chains, which contribute to its properties as a lipid. This substance is typically found in various natural oils and fats, and it plays a role in skin care formulations due to its emollient and moisturizing properties. Linoleyl linoleate is known for its ability to enhance skin barrier function and improve hydration, making it a valuable ingredient in cosmetic and personal care products. It is generally considered safe for topical use and is non-irritating, which adds to its appeal in formulations aimed at sensitive skin. Additionally, it may exhibit antioxidant properties, helping to protect skin from oxidative stress. As a fatty acid derivative, it is soluble in organic solvents and has a relatively low volatility, which contributes to its stability in formulations. Overall, linoleyl linoleate is appreciated for its functional benefits in enhancing the texture and efficacy of various products.
Formula:C36H64O2
InChI:InChI=1S/C36H64O2/c1-3-5-7-9-11-13-15-17-19-21-23-25-27-29-31-33-35-38-36(37)34-32-30-28-26-24-22-20-18-16-14-12-10-8-6-4-2/h11-14,17-20H,3-10,15-16,21-35H2,1-2H3/b13-11-,14-12-,19-17-,20-18-
InChI key:BWPODKUVJMQURN-MAZCIEHSSA-N
SMILES:CCCCC/C=C\C/C=C\CCCCCCCCOC(=O)CCCCCCC/C=C\C/C=C\CCCCC
Found 2 products.