CAS 17730-18-6
:1-[(Phenylmethoxy)carbonyl]-L-prolyl-L-methionine
Description:
1-[(Phenylmethoxy)carbonyl]-L-prolyl-L-methionine, with the CAS number 17730-18-6, is a synthetic compound that belongs to the class of amino acid derivatives. This substance features a proline and methionine backbone, which are both essential amino acids, and is modified with a phenylmethoxycarbonyl group. The presence of this protective group enhances the compound's stability and solubility, making it useful in various biochemical applications. The compound is typically characterized by its molecular structure, which includes a phenyl ring, an ether linkage, and a carboxyl group, contributing to its unique chemical properties. It is often studied for its potential roles in peptide synthesis and as a building block in the development of pharmaceuticals. Additionally, its chirality, stemming from the L-configuration of the amino acids, can influence its biological activity and interactions with enzymes or receptors. Overall, this compound exemplifies the complexity and versatility of amino acid derivatives in medicinal chemistry.
Formula:C18H24N2O5S
InChI:InChI=1S/C18H24N2O5S/c1-26-11-9-14(17(22)23)19-16(21)15-8-5-10-20(15)18(24)25-12-13-6-3-2-4-7-13/h2-4,6-7,14-15H,5,8-12H2,1H3,(H,19,21)(H,22,23)/t14-,15-/m0/s1
InChI key:InChIKey=QHSSZNCPOQRYPJ-GJZGRUSLSA-N
SMILES:C(N[C@@H](CCSC)C(O)=O)(=O)[C@H]1N(C(OCC2=CC=CC=C2)=O)CCC1
Synonyms:- 1-[(Benzyloxy)Carbonyl]Prolylmethionine
- 1-[(Phenylmethoxy)carbonyl]-<span class="text-smallcaps">L</smallcap>-prolyl-<smallcap>L</span>-methionine
- <span class="text-smallcaps">L</smallcap>-Methionine, 1-[(phenylmethoxy)carbonyl]-<smallcap>L</span>-prolyl-
- <span class="text-smallcaps">L</smallcap>-Methionine, N-[1-[(phenylmethoxy)carbonyl]-<smallcap>L</span>-prolyl]-
- Methionine, N-(1-carboxy-<span class="text-smallcaps">L</smallcap>-prolyl)-, N-benzyl ester, <smallcap>L</span>-
- N-(1-((Phenylmethoxy)carbonyl)-L-prolyl)-L-methionine
- NSC 334030
- Methionine, N-(1-carboxy-L-prolyl)-, N-benzyl ester, L-
- 1-[(Phenylmethoxy)carbonyl]-L-prolyl-L-methionine
- L-Methionine, 1-[(phenylmethoxy)carbonyl]-L-prolyl-
- L-Methionine, N-[1-[(phenylmethoxy)carbonyl]-L-prolyl]-
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 2 products.
Z-Pro-Met-OH
CAS:Z-Pro-Met-OH is a potent inhibitor of protein kinases. It has been shown to be resistant to peptidyl and sulphonium activation and also inhibits trypsin and other proteases. Z-Pro-Met-OH is a chloromethane derivative that is both an inhibitor of protein kinases and a substrate for the enzyme, which generates a constant concentration of product in the presence of enzyme. Z-Pro-Met-OH is more sensitive than other inhibitors tested to date, with the exception of staurosporine. It has sequence similarity to mammalian proteins, but lacks homology with any known protein.
Formula:C18H24N2O5SPurity:Min. 95%Molecular weight:380.46 g/mol

