CymitQuimica logo

CAS 177325-75-6

:

Phenol, 2,4-bis(phenylsulfonyl)-

Description:
Phenol, 2,4-bis(phenylsulfonyl)-, also known by its CAS number 177325-75-6, is an organic compound characterized by the presence of two phenylsulfonyl groups attached to a phenolic ring. This compound typically exhibits properties associated with both phenols and sulfonyl groups, including moderate solubility in organic solvents and potential reactivity due to the presence of the sulfonyl moieties. The sulfonyl groups can enhance the compound's electrophilic character, making it useful in various chemical reactions, including nucleophilic substitutions. Additionally, the presence of multiple aromatic rings contributes to its stability and potential applications in materials science, pharmaceuticals, and as a reagent in organic synthesis. The compound may also exhibit biological activity, although specific biological properties would depend on the context of its use. Safety data should be consulted for handling and exposure guidelines, as compounds with sulfonyl groups can sometimes pose health risks. Overall, 2,4-bis(phenylsulfonyl)phenol is a versatile compound with applications in various fields of chemistry.
Formula:C18H14O5S2
InChI:InChI=1S/C18H14O5S2/c19-17-12-11-16(24(20,21)14-7-3-1-4-8-14)13-18(17)25(22,23)15-9-5-2-6-10-15/h1-13,19H
InChI key:LCJQCYQTWIAJBE-UHFFFAOYSA-N
SMILES:C1=CC=C(C=C1)S(=O)(=O)C2=CC(=C(C=C2)O)S(=O)(=O)C3=CC=CC=C3
Synonyms:
  • Bis(phenylsulfonyl)phenol
Found 5 products.