CymitQuimica logo

CAS 17740-40-8

:

diethyl 1-benzylpyrrolidine-2,5-dicarboxylate

Description:
Diethyl 1-benzylpyrrolidine-2,5-dicarboxylate is a chemical compound characterized by its unique structure, which includes a pyrrolidine ring substituted with benzyl and two ester functional groups derived from diethyl dicarboxylate. This compound typically appears as a colorless to pale yellow liquid or solid, depending on its purity and specific conditions. It is known for its potential applications in organic synthesis and medicinal chemistry, particularly as a building block for various pharmaceuticals. The presence of the pyrrolidine ring contributes to its basicity and potential reactivity in various chemical reactions, including nucleophilic substitutions and cycloadditions. Additionally, the diethyl ester groups enhance its solubility in organic solvents, making it useful in various synthetic pathways. Safety data should be consulted for handling, as with many organic compounds, it may pose health risks if ingested or inhaled. Overall, diethyl 1-benzylpyrrolidine-2,5-dicarboxylate is a versatile compound with significant implications in chemical research and development.
Formula:C17H23NO4
InChI:InChI=1/C17H23NO4/c1-3-21-16(19)14-10-11-15(17(20)22-4-2)18(14)12-13-8-6-5-7-9-13/h5-9,14-15H,3-4,10-12H2,1-2H3
InChI key:LDUSEIANLSWKPY-UHFFFAOYSA-N
SMILES:CCOC(=O)C1CCC(C(=O)OCC)N1Cc1ccccc1
Found 4 products.