CymitQuimica logo

CAS 177415-76-8

:

bispyrazolone

Description:
Bisyrazolone, identified by its CAS number 177415-76-8, is a chemical compound characterized by the presence of two pyrazolone rings. This compound typically exhibits properties associated with its heterocyclic structure, including potential reactivity due to the presence of nitrogen atoms in the pyrazolone rings. Bisyrazolone may demonstrate various biological activities, making it of interest in medicinal chemistry and pharmacology. Its solubility can vary depending on the substituents attached to the pyrazolone rings, influencing its application in different solvents or formulations. Additionally, the compound may exhibit specific spectral characteristics, such as UV-Vis absorbance, which can be utilized for analytical purposes. The presence of functional groups in its structure can also impart unique chemical reactivity, allowing for potential derivatization or interaction with other chemical entities. Overall, bispyrazolone represents a versatile compound with potential applications in various fields, including drug development and materials science.
Formula:C20H18N4O2
InChI:InChI=1S/C20H18N4O2/c1-13-17(19(25)23(21-13)15-9-5-3-6-10-15)18-14(2)22-24(20(18)26)16-11-7-4-8-12-16/h3-12,21-22H,1-2H3
InChI key:CIJVXSIRUQCTBV-UHFFFAOYSA-N
SMILES:CC1=C(C(=O)N(N1)C2=CC=CC=C2)C3=C(NN(C3=O)C4=CC=CC=C4)C
Found 6 products.