CymitQuimica logo

CAS 17763-91-6

:

catechol bis(trifluoromethanesulfonate)

Description:
Catechol bis(trifluoromethanesulfonate), with the CAS number 17763-91-6, is a chemical compound characterized by its structure, which features a catechol moiety (a benzene ring with two hydroxyl groups in the 1,2-positions) that is substituted with two trifluoromethanesulfonate groups. This compound is typically a white to off-white solid and is known for its high reactivity, particularly in nucleophilic substitution reactions due to the presence of the trifluoromethanesulfonate leaving groups. It is often used as a reagent in organic synthesis, particularly in the formation of various derivatives of catechol and in the preparation of complex organic molecules. The trifluoromethanesulfonate groups enhance the solubility of the compound in polar solvents and contribute to its stability under certain conditions. Additionally, catechol bis(trifluoromethanesulfonate) is valued in the field of medicinal chemistry and materials science for its potential applications in drug development and polymer synthesis. Safety precautions should be observed when handling this compound due to its reactive nature and potential toxicity.
Formula:C8H4F6O6S2
InChI:InChI=1/C8H4F6O6S2/c9-7(10,11)21(15,16)19-5-3-1-2-4-6(5)20-22(17,18)8(12,13)14/h1-4H
InChI key:XISAIQHXAICQIV-UHFFFAOYSA-N
SMILES:c1ccc(c(c1)OS(=O)(=O)C(F)(F)F)OS(=O)(=O)C(F)(F)F
Synonyms:
  • Benzene-1,2-Diyl Bis(Trifluoromethanesulfonate)
Found 6 products.