CymitQuimica logo

CAS 177799-16-5

:

LT-N507

Description:
LT-N507, with the CAS number 177799-16-5, is a chemical compound that belongs to a class of substances known for their specific applications in various fields, including pharmaceuticals and materials science. While detailed characteristics such as its molecular structure, physical properties, and reactivity may vary, compounds like LT-N507 typically exhibit unique functional groups that contribute to their biological activity or material properties. These characteristics can include solubility in various solvents, stability under different conditions, and specific interactions with biological targets or other materials. Additionally, LT-N507 may have implications in research or industrial applications, potentially serving as a precursor or intermediate in the synthesis of more complex molecules. For precise information regarding its safety, handling, and regulatory status, consulting safety data sheets and relevant literature is essential. Always ensure to refer to updated databases or scientific publications for the most accurate and comprehensive data regarding this compound.
Formula:C42H36N2
InChI:InChI=1S/C42H36N2/c1-29-13-21-33(22-14-29)43(34-23-15-30(2)16-24-34)41-37-9-5-7-11-39(37)42(40-12-8-6-10-38(40)41)44(35-25-17-31(3)18-26-35)36-27-19-32(4)20-28-36/h5-28H,1-4H3
InChI key:FWXNJWAXBVMBGL-UHFFFAOYSA-N
SMILES:CC1=CC=C(C=C1)N(C2=CC=C(C=C2)C)C3=C4C=CC=CC4=C(C5=CC=CC=C53)N(C6=CC=C(C=C6)C)C7=CC=C(C=C7)C
Synonyms:
  • 9,10-Bis[N,N-di-(p-tolyl)-amino]anthracene
  • Ttpa
Found 5 products.