CAS 17788-94-2
:4,4''-dibromo-p-terphenyl
Description:
4,4''-Dibromo-p-terphenyl is an organic compound characterized by its structure, which consists of three connected phenyl rings with bromine substituents at the para positions of the outer rings. This compound is typically a white to light yellow solid at room temperature and is known for its stability and relatively low solubility in water, making it more soluble in organic solvents such as chloroform or dichloromethane. It exhibits interesting photophysical properties, which can be utilized in various applications, including organic electronics and as a potential phosphorescent material. The presence of bromine atoms enhances its reactivity and can facilitate further chemical modifications. Additionally, 4,4''-dibromo-p-terphenyl is often studied for its role in the synthesis of other complex organic molecules and materials. Safety precautions should be taken when handling this compound, as it may pose health risks if ingested or inhaled, and proper disposal methods should be followed to mitigate environmental impact.
Formula:C18H12Br2
InChI:InChI=1/C18H12Br2/c19-17-9-5-15(6-10-17)13-1-2-14(4-3-13)16-7-11-18(20)12-8-16/h1-12H
SMILES:c1cc(ccc1c1ccc(cc1)Br)c1ccc(cc1)Br
Synonyms:- 4,4''-Dibromo-1,1':4',1''-Terphenyl
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 6 products.
4,4''-Dibromo-1,1':4',1''-terphenyl
CAS:Formula:C18H12Br2Purity:98%Color and Shape:SolidMolecular weight:388.0959Ref: IN-DA003KEX
250mgTo inquire500gTo inquire1g20.00€5g43.00€10g67.00€25g129.00€50g202.00€100g288.00€4,4''-Dibromo-1,1':4',1''-terphenyl
CAS:4,4''-Dibromo-1,1':4',1''-terphenylFormula:C18H12Br2Purity:97%Color and Shape:SolidMolecular weight:388.1024,4''-Dibromo-p-terphenyl
CAS:Formula:C18H12Br2Purity:>95.0%(GC)Color and Shape:White to Gray to Brown powder to crystalMolecular weight:388.104,4''-Dibromo-1,1':4',1''-terphenyl
CAS:4,4''-Dibromo-1,1':4',1''-terphenylFormula:C18H12Br2Purity:97%Molecular weight:388.14,4”-Dibromo-1,1′:4′,1”-terphenyl
CAS:Formula:C18H12Br2Purity:98%Color and Shape:Solid, White to greyish reddish yellow powderMolecular weight:388.1024,4''-Dibromo-p-terphenyl
CAS:4,4''-Dibromo-p-terphenyl is a polycyclic aromatic hydrocarbon that has been synthesized as a nanomaterial. This material has been studied by XPS and microscopy as well as by kinetic experiments. The energetics of the reaction have been studied using photoelectron spectroscopy. 4,4''-Dibromo-p-terphenyl dehalogenates organometallic compounds at a rate that can be calculated using rate equations. The mechanistic study of the reaction was done through synthesizing 4,4''-Dibromo-p-terphenyl.Purity:Min. 95%





