CymitQuimica logo

CAS 1779121-90-2

:

Ethyl 3-bromo-6,7-dihydro-5H-pyrazolo[5,1-b][1,3]oxazine-2-carboxylate

Description:
Ethyl 3-bromo-6,7-dihydro-5H-pyrazolo[5,1-b][1,3]oxazine-2-carboxylate is a chemical compound characterized by its complex heterocyclic structure, which includes a pyrazolo and oxazine moiety. This compound features a bromine atom at the 3-position, contributing to its reactivity and potential applications in organic synthesis. The ethyl ester functional group enhances its solubility in organic solvents, making it suitable for various chemical reactions. The presence of the carboxylate group indicates potential for further functionalization, allowing for the synthesis of derivatives. Its unique structure may impart specific biological activities, making it of interest in medicinal chemistry. The compound's stability, reactivity, and potential interactions with biological systems can be influenced by the presence of the bromine atom and the overall electronic configuration of the molecule. As with many heterocycles, it may exhibit interesting properties such as fluorescence or specific binding affinities, which can be explored in pharmaceutical research. Safety and handling precautions should be observed due to the presence of bromine and the potential for biological activity.
Formula:C9H11BrN2O3
InChI:InChI=1S/C9H11BrN2O3/c1-2-14-9(13)7-6(10)8-12(11-7)4-3-5-15-8/h2-5H2,1H3
InChI key:InChIKey=MTPVDOWFOIXMFF-UHFFFAOYSA-N
SMILES:BrC1=C2N(N=C1C(OCC)=O)CCCO2
Synonyms:
  • 5H-Pyrazolo[5,1-b][1,3]oxazine-2-carboxylic acid, 3-bromo-6,7-dihydro-, ethyl ester
  • 3-Bromo-6,7-dihydro-5H-pyrazolo[5,1-b][1,3]oxazine-2-carboxylic acid ethyl ester
  • Ethyl 3-bromo-6,7-dihydro-5H-pyrazolo[5,1-b][1,3]oxazine-2-carboxylate
Found 4 products.