CymitQuimica logo

CAS 177947-96-5

:

3-Formyl-Azetidine-1-Carboxylic acid Tert-butyl ester

Description:
3-Formyl-Azetidine-1-Carboxylic acid tert-butyl ester is a chemical compound characterized by its azetidine ring structure, which is a four-membered cyclic amine. The presence of a formyl group (-CHO) indicates that it has an aldehyde functional group, contributing to its reactivity and potential applications in organic synthesis. The tert-butyl ester moiety provides steric hindrance, which can influence the compound's reactivity and solubility in various solvents. This compound is typically used in the synthesis of more complex molecules and may serve as an intermediate in pharmaceutical or agrochemical development. Its unique structure allows for various chemical transformations, making it a valuable building block in synthetic organic chemistry. Additionally, the compound's properties, such as melting point, boiling point, and solubility, can vary based on the specific conditions and purity of the sample. As with many chemical substances, safety precautions should be taken when handling it, as it may pose health risks or environmental hazards.
Formula:C9H15NO3
InChI:InChI=1S/C9H15NO3/c1-9(2,3)13-8(12)10-4-7(5-10)6-11/h6-7H,4-5H2,1-3H3
InChI key:JVQOZRRUGOADSU-UHFFFAOYSA-N
SMILES:CC(C)(C)OC(=O)N1CC(C1)C=O
Synonyms:
  • Tert-Butyl 3-Formylazetidine-1-Carboxylate
  • 1-Boc-3-azetidinecarboxaldehyde
  • Azetidine-3-carboxaldehyde, N1-Boc protected
Found 7 products.