CymitQuimica logo

CAS 178176-80-2

:

2-Diphenylphosphino-1-naphthoic acid

Description:
2-Diphenylphosphino-1-naphthoic acid is an organophosphorus compound characterized by the presence of a diphenylphosphino group attached to a naphthoic acid moiety. This compound typically exhibits a solid state at room temperature and is known for its role as a ligand in coordination chemistry, particularly in catalysis and organometallic chemistry. The presence of the phosphine group allows it to coordinate with various metal centers, enhancing the reactivity and selectivity of catalytic processes. Its naphthoic acid component contributes to its aromatic character, which can influence solubility and stability in organic solvents. Additionally, the compound may exhibit interesting optical properties due to its conjugated structure. Safety data indicates that, like many organophosphorus compounds, it should be handled with care, as it may pose health risks if ingested or inhaled. Overall, 2-Diphenylphosphino-1-naphthoic acid is valued for its versatility in synthetic applications and its ability to facilitate various chemical transformations.
Formula:C23H17O2P
InChI:InChI=1/C23H17O2P/c24-23(25)22-20-14-8-7-9-17(20)15-16-21(22)26(18-10-3-1-4-11-18)19-12-5-2-6-13-19/h1-16H,(H,24,25)
InChI key:WJCBDBBZIGUHOB-UHFFFAOYSA-N
SMILES:c1ccc(cc1)P(c1ccccc1)c1ccc2ccccc2c1C(=O)O
Synonyms:
  • 2-(Diphenylphosphanyl)Naphthalene-1-Carboxylic Acid
Found 4 products.