CymitQuimica logo

CAS 17821-75-9

:

5-Fluorobenzo-2,1,3-thiadiazole

Description:
5-Fluorobenzo-2,1,3-thiadiazole is a heterocyclic compound characterized by a benzene ring fused with a thiadiazole moiety, which contains sulfur and nitrogen atoms. The presence of a fluorine atom at the 5-position of the benzene ring enhances its reactivity and influences its electronic properties, making it of interest in various chemical applications. This compound typically exhibits a pale yellow to light brown appearance and is soluble in organic solvents. Its molecular structure contributes to its potential use in pharmaceuticals, agrochemicals, and as a building block in organic synthesis. The thiadiazole ring is known for its biological activity, and derivatives of this compound may exhibit antimicrobial, antifungal, or anticancer properties. Additionally, the fluorine substitution can improve the metabolic stability and bioavailability of compounds in medicinal chemistry. As with many heterocycles, the compound's reactivity can be influenced by the electronic effects of the fluorine atom and the overall molecular geometry. Safety data should be consulted for handling and usage, as with any chemical substance.
Formula:C6H3FN2S
InChI:InChI=1S/C6H3FN2S/c7-4-1-2-5-6(3-4)9-10-8-5/h1-3H
InChI key:LNZHAYNBUMVVBK-UHFFFAOYSA-N
SMILES:C1=CC2=NSN=C2C=C1F
Found 4 products.