CymitQuimica logo

CAS 17826-04-9

:

6-Bromoindole-3-carboxaldehyde

Description:
6-Bromoindole-3-carboxaldehyde is an organic compound characterized by its indole structure, which is a bicyclic compound consisting of a benzene ring fused to a pyrrole ring. The presence of a bromine atom at the 6-position and an aldehyde functional group at the 3-position contributes to its reactivity and potential applications in organic synthesis and medicinal chemistry. This compound typically appears as a solid and is known for its role as an intermediate in the synthesis of various pharmaceuticals and biologically active molecules. Its reactivity is influenced by the electron-withdrawing nature of the aldehyde group, which can participate in nucleophilic addition reactions. Additionally, the bromine substituent can facilitate further functionalization through cross-coupling reactions. The compound is generally handled with standard safety precautions due to its potential toxicity and reactivity. Overall, 6-Bromoindole-3-carboxaldehyde serves as a valuable building block in the development of complex organic compounds.
Formula:C10H30O3Si4
InChI:InChI=1/C10H30O3Si4/c1-14(2,3)11-17(10,12-15(4,5)6)13-16(7,8)9/h1-10H3
InChI key:WCCLQCBKBPTODV-UHFFFAOYSA-N
SMILES:C[Si](C)(C)O[Si](C)(O[Si](C)(C)C)O[Si](C)(C)C
Synonyms:
  • 6-Bromo-1H-Indole-3-Carbaldehyde
  • 6-Bromo-1H-Indole-3-Carboxaldehyde
  • 6-Bromo-3-Formyl-1H-Indole
  • 6-Bromo-3-Formylindole
  • 6-Bromo-1H-indole-3-carbaldehyde, 6-Bromo-3-formylindole
  • 1,1,1,3,5,5,5-Heptamethyl-3-[(Trimethylsilyl)Oxy]Trisiloxane
Found 7 products.