CAS 178393-14-1
:1,3-Dihydro-5-methoxy-2H-pyrrolo[3,2-b]pyridin-2-one
Description:
1,3-Dihydro-5-methoxy-2H-pyrrolo[3,2-b]pyridin-2-one is a heterocyclic organic compound characterized by its unique bicyclic structure, which includes a pyrrole and a pyridine ring. This compound features a methoxy group (-OCH3) at the 5-position, contributing to its chemical reactivity and potential biological activity. The presence of the carbonyl group (C=O) in the pyrrolidine ring enhances its ability to participate in various chemical reactions, such as nucleophilic attacks. The compound is typically a solid at room temperature and may exhibit moderate solubility in polar solvents due to the presence of the methoxy group. Its structural features suggest potential applications in medicinal chemistry, particularly in the development of pharmaceuticals, as compounds with similar frameworks have been investigated for their biological activities, including anti-inflammatory and neuroprotective effects. However, specific data on its toxicity, stability, and detailed reactivity would require further investigation and experimental validation.
Formula:C8H8N2O2
InChI:InChI=1S/C8H8N2O2/c1-12-8-3-2-5-6(10-8)4-7(11)9-5/h2-3H,4H2,1H3,(H,9,11)
InChI key:InChIKey=HHKFJMBCHRBJOW-UHFFFAOYSA-N
SMILES:O=C1NC=2C(=NC(OC)=CC2)C1
Synonyms:- 2H-Pyrrolo[3,2-b]pyridin-2-one, 1,3-dihydro-5-methoxy-
- 1,3-Dihydro-5-methoxy-2H-pyrrolo[3,2-b]pyridin-2-one
- 5-Methoxy-1,3-dihydropyrrolo[3,2-b]pyridin-2-one
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
