CAS 1784253-05-9

Formula: C22H26Cl2N6O4S

InChI: InChI=1S/C22H25ClN6O4S.ClH/c1-32-20-13-15(29-9-11-33-12-10-29)7-8-19(20)26-22-24-14-16(23)21(27-22)25-17-5-3-4-6-18(17)28-34(2,30)31;/h3-8,13-14,28H,9-12H2,1-2H3,(H2,24,25,26,27);1H

InChI key: KWCBHUPLQMUKAF-UHFFFAOYSA-N

SMILES: COC1=C(C=CC(=C1)N2CCOCC2)NC3=NC=C(C(=N3)NC4=CC=CC=C4NS(=O)(=O)C)Cl.Cl

CZC-54252 hydrochloride

CAS: 1784253-05-9

CZC-54252 hydrochloride

Formula: C₂₂H₂₆Cl₂N₆O₄S

Purity: 99%

Molecular weight: 541.45

Ref: 54-BUP10681

CZC-54252 hydrochloride

CAS: 1784253-05-9

CZC-54252 hydrochloride: selective LRRK2 inhibitor; IC50 = 1.85/1.28 nM (wild-type/G2019S); neuroprotective; EC50 = 1 nM for G2019S injury.

Formula: C₂₂H₂₆Cl₂N₆O₄S

Purity: 99.28%

Color and Shape: Solid

Molecular weight: 541.45

Ref: TM-T39202

N-(2-((5-Chloro-2-((2-methoxy-4-morpholinophenyl)amino)pyrimidin-4-yl)amino)phenyl)methanesulfonamide hydrochloride

CAS: 1784253-05-9

Formula: C₂₂H₂₆Cl₂N₆O₄S

Purity: 98%

Color and Shape: Solid

Molecular weight: 541.4506

Ref: IN-DA01LQQX

CZC 54252 hydrochloride

CAS: 1784253-05-9

CZC 54252 hydrochloride is a cancer drug that inhibits the growth of cancer cells by inhibiting the production of DNA and RNA. It binds to topoisomerase II, which is an enzyme that maintains the integrity of DNA. CZC 54252 hydrochloride also inhibits protein synthesis, leading to cell death. This drug has been shown to be effective against a variety of cancers, such as colon and lung cancer.

Formula: C₂₂H₂₆Cl₂N₆O₄S

Purity: Min. 95%

Molecular weight: 541.4 g/mol

Ref: 3D-JWC25305