CymitQuimica logo

CAS 17847-40-4

:

(3,4-DICHLORO-PHENYL)-ETHYL-AMINE

Description:
(3,4-Dichloro-phenyl)-ethyl-amine, identified by its CAS number 17847-40-4, is an organic compound characterized by the presence of a phenyl ring substituted with two chlorine atoms at the 3 and 4 positions, along with an ethylamine group. This structure imparts both hydrophobic and hydrophilic properties, making it potentially useful in various chemical applications. The dichlorophenyl moiety contributes to its biological activity, which may include interactions with neurotransmitter systems or other biological pathways. The compound is typically a solid at room temperature and may exhibit moderate solubility in organic solvents. Its reactivity can be influenced by the presence of the amine group, which can participate in various chemical reactions, including alkylation and acylation. Safety data should be consulted, as halogenated compounds can pose environmental and health risks. Overall, (3,4-Dichloro-phenyl)-ethyl-amine is of interest in fields such as medicinal chemistry and materials science due to its unique structural features and potential applications.
Formula:C8H9Cl2N
InChI:InChI=1S/C8H9Cl2N/c1-2-11-6-3-4-7(9)8(10)5-6/h3-5,11H,2H2,1H3
InChI key:AUKQGMBZOYBQCU-UHFFFAOYSA-N
SMILES:CCNC1=CC(=C(C=C1)Cl)Cl
Synonyms:
  • 3,4-Dichloro-N-Ethylbenzenamine
Found 4 products.