CAS 17865-11-1
:[4-(Trimethylsilyl)phenyl]boronic acid
Description:
[4-(Trimethylsilyl)phenyl]boronic acid is an organoboron compound characterized by the presence of a boronic acid functional group attached to a phenyl ring that is further substituted with a trimethylsilyl group. This compound typically exhibits properties such as being a white to off-white solid at room temperature, with moderate solubility in organic solvents like dichloromethane and toluene, while being less soluble in water due to the hydrophobic nature of the trimethylsilyl group. The boronic acid moiety allows for participation in various chemical reactions, particularly in Suzuki coupling reactions, making it valuable in organic synthesis and materials science. Additionally, the trimethylsilyl group enhances the stability and volatility of the compound, which can be advantageous in certain applications. Its reactivity and functionalization potential make it a useful intermediate in the synthesis of pharmaceuticals and agrochemicals. Safety precautions should be taken when handling this compound, as with many organoboron compounds, due to potential irritant properties.
Formula:C9H15BO2Si
InChI:InChI=1S/C9H15BO2Si/c1-13(2,3)9-6-4-8(5-7-9)10(11)12/h4-7,11-12H,1-3H3
InChI key:InChIKey=NRPZMSUGPMYBCQ-UHFFFAOYSA-N
SMILES:[Si](C)(C)(C)C1=CC=C(B(O)O)C=C1
Synonyms:- 4-(Trimethylsilyl)benzeneboronic acid
- 4-Triemthylsilylphenylboronic Acid
- 4-Trimethylsilylbenzeneboronic Acid
- Akos Brn-0431
- B-[4-(Trimethylsilyl)phenyl]boronic acid
- Benzeneboronic acid, p-(trimethylsilyl)-
- Boronic acid, B-[4-(trimethylsilyl)phenyl]-
- Boronic acid, [4-(trimethylsilyl)phenyl]-
- P-(Trimethylsilyl)Phenylboronic Acid
- [4-(Trimethylsilyl)phenyl]boronic acid
- p-Trimethylsilylbenzeneboronic acid
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 5 products.
4-(Trimethylsilyl)phenylboronic Acid (contains varying amounts of Anhydride)
CAS:Formula:C9H15BO2SiColor and Shape:White to Almost white powder to crystalMolecular weight:194.11(4-(Trimethylsilyl)phenyl)boronic acid
CAS:(4-(Trimethylsilyl)phenyl)boronic acidFormula:C9H15BO2SiPurity:95%Color and Shape:SolidMolecular weight:194.11069Boronic acid, B-[4-(trimethylsilyl)phenyl]-
CAS:Formula:C9H15BO2SiPurity:95%Color and Shape:SolidMolecular weight:194.11074-Trimethylsilyl phenyl boronic acid
CAS:S20001 - 4-Trimethylsilyl phenyl boronic acid
Formula:C9H15BO2SiPurity:95%Color and Shape:SolidMolecular weight:194.114-(Trimethylsilyl)pheNylboroNic acid
CAS:4-(Trimethylsilyl)phenylboronic acid is a molecule that can be used as an acceptor in fluorescence. It has been shown to have acceptor properties, which means it is able to absorb light energy and transfer it to other molecules. This chemical can be used in microscopy and cross-coupling reactions. 4-(Trimethylsilyl)phenylboronic acid has been shown to undergo thermally activated transport properties and to be isomeric. The molecule also has cross-coupling reactions with anilines, which are important for the production of pharmaceuticals and other organic compounds. 4-(Trimethylsilyl)phenylboronic acid has a high affinity for chloride ions, making it a good candidate for use in solar cells.
Formula:C9H15BO2SiPurity:Min. 95%Molecular weight:194.11 g/mol




