CAS 178752-79-9
:[3-(Dimethylamino)phenyl]-boronic acid
Description:
[3-(Dimethylamino)phenyl]-boronic acid is an organic compound characterized by the presence of a boronic acid functional group attached to a phenyl ring that has a dimethylamino substituent. This compound typically exhibits properties associated with both boronic acids and amines, including the ability to form reversible covalent bonds with diols, making it useful in various applications such as organic synthesis and medicinal chemistry. The dimethylamino group enhances its solubility in polar solvents and can influence its reactivity and interaction with biological systems. Additionally, boronic acids are known for their role in Suzuki coupling reactions, which are pivotal in the formation of carbon-carbon bonds in organic synthesis. The compound's structure allows it to participate in various chemical reactions, making it a valuable intermediate in the development of pharmaceuticals and agrochemicals. Its unique properties stem from the interplay between the boron atom's electron-deficient nature and the electron-donating characteristics of the dimethylamino group, contributing to its reactivity and potential applications in material science and drug development.
Formula:C8H12BNO2
InChI:InChI=1/C8H12BNO2/c1-10(2)8-5-3-4-7(6-8)9(11)12/h3-6,11-12H,1-2H3
SMILES:CN(C)c1cccc(c1)B(O)O
Synonyms:- 3-Dimethylaminophenylboronic acid
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 4 products.
Boronic acid, B-[3-(dimethylamino)phenyl]-
CAS:Formula:C8H12BNO2Purity:95%Color and Shape:SolidMolecular weight:164.99743-(Dimethylamino)benzeneboronic acid
CAS:3-(Dimethylamino)benzeneboronic acidFormula:C8H12BNO2Purity:99%Color and Shape: off white to light brown solidMolecular weight:164.99737g/mol3-(Dimethylamino)phenylboronic acid
CAS:Formula:C8H12BNO2Purity:95%Color and Shape:SolidMolecular weight:1653-(N,N-Dimethylamino)phenylboronic Acid
CAS:Controlled ProductApplications 3-(N,N-Dimethylamino)phenylboronic Acid (cas# 178752-79-9) is a compound useful in organic synthesis.
Not a dangerous good if item is equal to or less than 1g/ml and there is less than 100g/ml in the packageFormula:C8H12BNO2Color and Shape:NeatMolecular weight:165.00



