CAS 178752-79-9

[3-(Dimethylamino)phenyl]-boronic acid

Description:

[3-(Dimethylamino)phenyl]-boronic acid is an organic compound characterized by the presence of a boronic acid functional group attached to a phenyl ring that has a dimethylamino substituent. This compound typically exhibits properties associated with both boronic acids and amines, including the ability to form reversible covalent bonds with diols, making it useful in various applications such as organic synthesis and medicinal chemistry. The dimethylamino group enhances its solubility in polar solvents and can influence its reactivity and interaction with biological systems. Additionally, boronic acids are known for their role in Suzuki coupling reactions, which are pivotal in the formation of carbon-carbon bonds in organic synthesis. The compound's structure allows it to participate in various chemical reactions, making it a valuable intermediate in the development of pharmaceuticals and agrochemicals. Its unique properties stem from the interplay between the boron atom's electron-deficient nature and the electron-donating characteristics of the dimethylamino group, contributing to its reactivity and potential applications in material science and drug development.

Formula: C₈H₁₂BNO₂

InChI: InChI=1/C8H12BNO2/c1-10(2)8-5-3-4-7(6-8)9(11)12/h3-6,11-12H,1-2H3

SMILES: CN(C)c1cccc(c1)B(O)O

Synonyms:

• 3-Dimethylaminophenylboronic acid

Boronic acid, B-[3-(dimethylamino)phenyl]-

CAS: 178752-79-9

Formula: C₈H₁₂BNO₂

Purity: 95%

Color and Shape: Solid

Molecular weight: 164.9974

Ref: IN-DA0026A8

3-(Dimethylamino)benzeneboronic acid

CAS: 178752-79-9

3-(Dimethylamino)benzeneboronic acid

Formula: C₈H₁₂BNO₂

Purity: 99%

Color and Shape: Solid

Molecular weight: 164.99737

Ref: 54-OR2015

3-(Dimethylamino)phenylboronic acid

CAS: 178752-79-9

Formula: C₈H₁₂BNO₂

Purity: 95%

Color and Shape: Solid

Molecular weight: 165

Ref: 10-F045272

3-(N,N-Dimethylamino)phenylboronic Acid

Controlled Product

CAS: 178752-79-9

Applications 3-(N,N-Dimethylamino)phenylboronic Acid (cas# 178752-79-9) is a compound useful in organic synthesis.
Not a dangerous good if item is equal to or less than 1g/ml and there is less than 100g/ml in the package

Formula: C₈H₁₂BNO₂

Color and Shape: Neat

Molecular weight: 165.00

Ref: TR-D461625