CymitQuimica logo

CAS 1788054-80-7

:

2H-Indazole-4-methanamine, 2-methyl-, hydrochloride (1:1)

Description:
2H-Indazole-4-methanamine, 2-methyl-, hydrochloride (1:1) is a chemical compound characterized by its indazole core, which is a bicyclic structure containing a five-membered ring fused to a six-membered ring. This compound features a methanamine group and a methyl substituent at the 2-position of the indazole ring, contributing to its unique properties. As a hydrochloride salt, it is typically more soluble in water compared to its free base form, enhancing its utility in various applications, particularly in pharmaceutical contexts. The presence of the hydrochloride group also influences its stability and bioavailability. The compound may exhibit biological activity, potentially serving as a precursor or intermediate in the synthesis of more complex molecules. Its specific interactions and effects would depend on the functional groups present and the overall molecular structure. As with many chemical substances, safety data and handling precautions should be considered, particularly in laboratory or industrial settings.
Formula:C9H11N3·ClH
InChI:InChI=1S/C9H11N3.ClH/c1-12-6-8-7(5-10)3-2-4-9(8)11-12;/h2-4,6H,5,10H2,1H3;1H
InChI key:InChIKey=YZDSFMLBGIMEHN-UHFFFAOYSA-N
SMILES:C(N)C=1C=2C(=NN(C)C2)C=CC1.Cl
Synonyms:
  • 2H-Indazole-4-methanamine, 2-methyl-, hydrochloride (1:1)
Found 2 products.