CymitQuimica logo

CAS 178931-63-0

:

Stannane, [2,2':5',2''-terthiophene]-5,5''-diylbis[trimethyl-

Description:
Stannane, [2,2':5',2''-terthiophene]-5,5''-diylbis[trimethyl-] is an organometallic compound characterized by the presence of a stannane functional group, which contains tin (Sn) bonded to organic moieties. This compound features a terthiophene backbone, consisting of three thiophene rings, which contributes to its electronic properties and potential applications in organic electronics, such as organic photovoltaics and field-effect transistors. The presence of trimethyl groups enhances its solubility and stability, making it suitable for various synthetic applications. The compound's structure suggests it may exhibit interesting optical and electronic characteristics due to the conjugated system formed by the thiophene units. Additionally, the stannane group can serve as a precursor for further reactions, including cross-coupling reactions, which are valuable in the synthesis of more complex organic materials. Overall, this compound exemplifies the intersection of organometallic chemistry and organic synthesis, with potential implications in advanced material science.
Formula:C18H24S3Sn2
InChI:InChI=1S/C12H6S3.6CH3.2Sn/c1-3-9(13-7-1)11-5-6-12(15-11)10-4-2-8-14-10;;;;;;;;/h1-6H;6*1H3;;
InChI key:FIKQPMKITUNTEK-UHFFFAOYSA-N
SMILES:C[Sn](C)(C)C1=CC=C(S1)C2=CC=C(S2)C3=CC=C(S3)[Sn](C)(C)C
Synonyms:
  • [2,2':5',2''-Terthiophene]-5,5''-Diylbis[Trimethylstannane]
Found 5 products.