CymitQuimica logo

CAS 179055-20-0

:

[4-(1-Methyl-1H-pyrazol-3-yl)phenyl]methanol

Description:
[4-(1-Methyl-1H-pyrazol-3-yl)phenyl]methanol, with the CAS number 179055-20-0, is an organic compound characterized by its phenolic structure, which includes a methanol group attached to a phenyl ring that is further substituted with a pyrazole moiety. This compound typically exhibits properties associated with both aromatic and heterocyclic compounds, such as moderate solubility in polar solvents due to the presence of the hydroxyl (-OH) group. The pyrazole ring contributes to its potential biological activity, making it of interest in medicinal chemistry. The compound may also display specific reactivity patterns typical of phenolic compounds, including the ability to participate in hydrogen bonding and act as an antioxidant. Its molecular structure suggests potential applications in pharmaceuticals, agrochemicals, or as a building block in organic synthesis. However, detailed studies on its specific physical and chemical properties, such as melting point, boiling point, and spectral characteristics, would be necessary for a comprehensive understanding of its behavior in various environments.
Formula:C11H12N2O
InChI:InChI=1/C11H12N2O/c1-13-7-6-11(12-13)10-4-2-9(8-14)3-5-10/h2-7,14H,8H2,1H3
InChI key:VCVJSWDSNWXXJT-UHFFFAOYSA-N
SMILES:Cn1ccc(c2ccc(cc2)CO)n1
Synonyms:
  • 4-(1-Methyl-1H-pyrazol-3-yl)benzyl alcohol
  • 4-(1-Methyl-1H-pyrazol-3-yl)benzyl alcohol 97%
  • [4-(1-Methylpyrazol-3-Yl)Phenyl]Methanol
Found 4 products.