CymitQuimica logo

CAS 179055-26-6

:

4-(N,O-Dimethylhydroxylaminocarbonyl)phenylboronic acid

Description:
4-(N,O-Dimethylhydroxylaminocarbonyl)phenylboronic acid is a boronic acid derivative characterized by the presence of a phenyl group attached to a boron atom, which is further substituted with a hydroxylamine carbonyl group. This compound typically exhibits properties associated with boronic acids, such as the ability to form reversible covalent bonds with diols, making it useful in various applications, including organic synthesis and medicinal chemistry. The presence of the hydroxylamine moiety can enhance its reactivity and selectivity in chemical reactions. Additionally, the compound may exhibit moderate solubility in polar solvents due to the presence of functional groups that can engage in hydrogen bonding. Its unique structure allows it to participate in cross-coupling reactions, which are essential in the formation of carbon-carbon bonds. Overall, 4-(N,O-Dimethylhydroxylaminocarbonyl)phenylboronic acid is a versatile compound with potential applications in drug development and materials science, owing to its functional properties and reactivity profile.
Formula:C9H12BNO4
InChI:InChI=1/C9H12BNO4/c1-11(15-2)9(12)7-3-5-8(6-4-7)10(13)14/h3-6,13-14H,1-2H3
InChI key:PISDDPDFGJLSQA-UHFFFAOYSA-N
SMILES:CN(C(=O)c1ccc(cc1)B(O)O)OC
Synonyms:
  • {4-[Methoxy(Methyl)Carbamoyl]Phenyl}Boronic Acid
Found 5 products.