CymitQuimica logo

CAS 179543-88-5

:

Pyridine, 5-hydrazino-2-methoxy-, monohydrochloride

Description:
Pyridine, 5-hydrazino-2-methoxy-, monohydrochloride is a chemical compound characterized by its pyridine ring structure, which is a six-membered aromatic ring containing one nitrogen atom. This compound features a hydrazino group (-NH-NH2) and a methoxy group (-OCH3) attached to the pyridine ring, contributing to its unique reactivity and properties. As a monohydrochloride salt, it exists in a protonated form, which enhances its solubility in polar solvents, particularly water. The presence of the hydrazino group suggests potential applications in organic synthesis, particularly in the formation of hydrazones and other nitrogen-containing compounds. Additionally, the methoxy group can influence the electronic properties of the molecule, affecting its reactivity and interaction with other chemical species. Pyridine derivatives are often studied for their biological activities, and this compound may exhibit interesting pharmacological properties, although specific biological data would need to be referenced for detailed insights. Overall, the compound's structure and functional groups make it a subject of interest in both synthetic and medicinal chemistry.
Formula:C6H10ClN3O
InChI:InChI=1S/C6H9N3O.ClH/c1-10-6-3-2-5(9-7)4-8-6;/h2-4,9H,7H2,1H3;1H
InChI key:GNBNHMWUFAOTLY-UHFFFAOYSA-N
SMILES:COC1=NC=C(C=C1)NN.Cl
Synonyms:
  • 5-Hydrazinyl-2-Methoxypyridine hydrochloride
  • 149498
  • Pyridine, 5-hydrazinyl-2-methoxy-, hydrochloride (1:1)
  • (6-Methoxy-pyridin-3-yl)-hydrazine hydrochloride
Found 4 products.