CymitQuimica logo

CAS 17965-74-1

:

1,6-Naphthyridine, 8-bromo-

Description:
1,6-Naphthyridine, 8-bromo- is a heterocyclic organic compound characterized by a bicyclic structure that includes a nitrogen atom in its ring system. This compound features a bromine substituent at the 8-position of the naphthyridine ring, which can influence its reactivity and properties. Typically, naphthyridines exhibit aromatic characteristics, contributing to their stability and potential for various chemical reactions, including electrophilic substitution. The presence of the bromine atom can enhance the compound's reactivity, making it useful in synthetic organic chemistry, particularly in the development of pharmaceuticals and agrochemicals. Additionally, 1,6-naphthyridine derivatives are known for their biological activity, which may include antimicrobial and anticancer properties. The compound is likely to be soluble in organic solvents and may have specific melting and boiling points that are characteristic of similar heterocyclic compounds. Overall, 1,6-Naphthyridine, 8-bromo- is a valuable compound in both research and industrial applications due to its unique structural features and potential reactivity.
Formula:C8H5BrN2
InChI:InChI=1/C8H5BrN2/c9-7-5-10-4-6-2-1-3-11-8(6)7/h1-5H
InChI key:InChIKey=PQBNZTONCGWKCZ-UHFFFAOYSA-N
SMILES:BrC=1C2=C(C=NC1)C=CC=N2
Synonyms:
  • 8-Bromo-1,6-naphthyridine
  • 1,6-Naphthyridine, 8-bromo-
  • 8-Bromo-1,6phthyridine
Found 4 products.