CAS 179688-01-8
:6-Methoxy-7-benzyloxyquinazolin-4-one
Description:
6-Methoxy-7-benzyloxyquinazolin-4-one is a synthetic organic compound belonging to the quinazolinone class, characterized by its fused bicyclic structure. This compound features a methoxy group (-OCH3) at the 6-position and a benzyloxy group (-O-Ph) at the 7-position of the quinazolinone ring, which contributes to its unique chemical properties and potential biological activities. The presence of these substituents can influence the compound's solubility, reactivity, and interaction with biological targets. Typically, quinazolinones are known for their diverse pharmacological activities, including anti-cancer, anti-inflammatory, and antimicrobial properties. The specific arrangement of functional groups in 6-Methoxy-7-benzyloxyquinazolin-4-one may enhance its efficacy in various applications, particularly in medicinal chemistry. Additionally, the compound's molecular structure allows for potential modifications that could lead to the development of new derivatives with improved therapeutic profiles. As with many organic compounds, safety and handling precautions should be observed due to potential toxicity or reactivity.
Formula:C16H14N2O3
InChI:InChI=1/C16H14N2O3/c1-20-14-7-12-13(17-10-18-16(12)19)8-15(14)21-9-11-5-3-2-4-6-11/h2-8,10H,9H2,1H3,(H,17,18,19)
SMILES:COc1cc2c(cc1OCc1ccccc1)ncnc2O
Synonyms:- 7-Benzyloxy-6-Methoxy-3H-Quinazolin-4-One
- 7-(Benzyloxy)-6-Methoxy-4(3H)-Quinazolinone
- 7-Benzyloxy-6-methoxyquinazolin-4-one
- 7-(benzyloxy)-6-methoxyquinazolin-4(1H)-one
- 6-methoxy-7-(phenylmethoxy)-4(3H)-Quinazolinone
- 7-Benzyloxy-6-methoxyquinazolin-4-ol
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 5 products.
7-Benzyloxy-6-methoxy-3H-quinazolin-4-one
CAS:Formula:C16H14N2O3Purity:>98.0%(T)(HPLC)Color and Shape:White to Almost white powder to crystalMolecular weight:282.307-Benzyloxy-6-methoxy-4(3H)-quinazolinone, 96%
CAS:This Thermo Scientific Chemicals brand product was originally part of the Alfa Aesar product portfolio. Some documentation and label information may refer to the legacy brand. The original Alfa Aesar product / item code or SKU reference has not changed as a part of the brand transition to Thermo SciFormula:C16H14N2O3Purity:96%Color and Shape:Pale cream, PowderMolecular weight:282.304(3H)-Quinazolinone, 6-methoxy-7-(phenylmethoxy)-
CAS:Formula:C16H14N2O3Purity:98%Color and Shape:SolidMolecular weight:282.29407-Benzyloxy-6-methoxy-4(3H)-quinazolinone
CAS:Purity:97.0%Color and Shape:SolidMolecular weight:282.299011230468757-(Benzyloxy)-6-methoxyquinazolin-4(1H)-one
CAS:7-(Benzyloxy)-6-methoxyquinazolin-4(1H)-oneFormula:C16H14N2O3Purity:98%Molecular weight:282.29396




