CymitQuimica logo

CAS 1799-47-9

:

ethyl 9H-perfluorononanoate

Description:
Ethyl 9H-perfluorononanoate, with the CAS number 1799-47-9, is a fluorinated organic compound characterized by its perfluorinated carbon chain and ester functional group. This substance features a long carbon chain, which contributes to its hydrophobic properties, while the presence of fluorine atoms enhances its chemical stability and resistance to degradation. Ethyl 9H-perfluorononanoate is typically colorless and may exhibit low volatility, making it useful in various applications, including as a surfactant or in specialty coatings. Its unique properties, such as low surface tension and high thermal stability, make it suitable for use in environments where conventional organic compounds may fail. Additionally, the compound's fluorinated nature imparts water and oil repellency, which can be advantageous in industrial applications. However, due to environmental concerns associated with perfluorinated compounds, its use may be subject to regulatory scrutiny. Overall, ethyl 9H-perfluorononanoate exemplifies the characteristics of fluorinated esters, combining stability with unique surface-active properties.
Formula:C11H6F16O2
InChI:InChI=1/C11H6F16O2/c1-2-29-4(28)6(16,17)8(20,21)10(24,25)11(26,27)9(22,23)7(18,19)5(14,15)3(12)13/h3H,2H2,1H3
InChI key:HRSRZMSDVRJBEZ-UHFFFAOYSA-N
SMILES:CCOC(=O)C(C(C(C(C(C(C(C(F)F)(F)F)(F)F)(F)F)(F)F)(F)F)(F)F)(F)F
Synonyms:
  • EthylHperfluorononanoate
  • Ethyl 2,2,3,3,4,4,5,5,6,6,7,7,8,8,9,9-Hexadecafluorononanoate
Found 3 products.