CymitQuimica logo

CAS 1801-06-5

:

4-Chloro-5-Fluoro-2-Methoxypyrimidine

Description:
4-Chloro-5-Fluoro-2-Methoxypyrimidine is a heterocyclic organic compound characterized by its pyrimidine ring, which is a six-membered aromatic ring containing two nitrogen atoms at positions 1 and 3. This compound features a chlorine atom at the 4-position and a fluorine atom at the 5-position, contributing to its reactivity and potential applications in pharmaceuticals and agrochemicals. The methoxy group (-OCH3) at the 2-position enhances its solubility and can influence its biological activity. The presence of halogens (chlorine and fluorine) often imparts unique electronic properties, making this compound of interest in medicinal chemistry for the development of new drugs. Its molecular structure allows for various synthetic modifications, which can lead to derivatives with tailored properties. Additionally, 4-Chloro-5-Fluoro-2-Methoxypyrimidine may exhibit specific interactions with biological targets, making it a candidate for further research in therapeutic applications. Safety and handling precautions should be observed due to the presence of halogens, which can pose health risks.
Formula:C5H4ClFN2O
InChI:InChI=1S/C5H4ClFN2O/c1-10-5-8-2-3(7)4(6)9-5/h2H,1H3
InChI key:SGXQCZHNMNMMEG-UHFFFAOYSA-N
SMILES:COC1=NC=C(C(=N1)Cl)F
Found 7 products.