CymitQuimica logo

CAS 1802489-64-0

:

Methyl 4-fluoropyrazolo[1,5-a]pyridine-3-carboxylate

Description:
Methyl 4-fluoropyrazolo[1,5-a]pyridine-3-carboxylate is a chemical compound characterized by its unique pyrazolo-pyridine structure, which incorporates a fluorine atom at the 4-position of the pyrazole ring. This compound features a carboxylate functional group, contributing to its potential reactivity and solubility in various solvents. The presence of the methyl ester group enhances its lipophilicity, making it suitable for biological applications. Methyl 4-fluoropyrazolo[1,5-a]pyridine-3-carboxylate is of interest in medicinal chemistry, particularly for its potential pharmacological properties, which may include anti-inflammatory or anti-cancer activities. The fluorine atom can influence the compound's electronic properties and biological interactions, making it a valuable target for drug development. Its molecular structure allows for various synthetic modifications, which can lead to the exploration of structure-activity relationships. As with many organic compounds, proper handling and safety measures should be observed due to potential toxicity or reactivity.
Formula:C9H7FN2O2
InChI:InChI=1S/C9H7FN2O2/c1-14-9(13)6-5-11-12-4-2-3-7(10)8(6)12/h2-5H,1H3
InChI key:InChIKey=IAJNMQKICSFNKH-UHFFFAOYSA-N
SMILES:C(OC)(=O)C1=C2N(N=C1)C=CC=C2F
Synonyms:
  • Pyrazolo[1,5-a]pyridine-3-carboxylic acid, 4-fluoro-, methyl ester
  • Methyl 4-fluoropyrazolo[1,5-a]pyridine-3-carboxylate
Found 3 products.