CymitQuimica logo

CAS 1803582-61-7

:

4H-1,2,4-Triazole-3-carboxylic acid, 4-methyl-5-phenyl-, lithium salt (1:1)

Description:
4H-1,2,4-Triazole-3-carboxylic acid, 4-methyl-5-phenyl-, lithium salt (1:1) is a chemical compound characterized by its triazole ring structure, which is a five-membered heterocyclic compound containing three nitrogen atoms. This compound features a carboxylic acid functional group, contributing to its acidic properties, and a lithium salt form, indicating that lithium ions are associated with the triazole structure. The presence of the methyl and phenyl groups enhances its hydrophobic characteristics, potentially influencing its solubility and reactivity. This compound may exhibit biological activity, making it of interest in pharmaceutical and agricultural applications. Its lithium salt form suggests potential uses in coordination chemistry or as a reagent in organic synthesis. The stability and reactivity of this compound can be influenced by factors such as pH, temperature, and the presence of other ions or solvents. Overall, this compound represents a unique combination of structural features that may confer specific chemical and biological properties.
Formula:C10H9N3O2·Li
InChI:InChI=1S/C10H9N3O2.Li/c1-13-8(7-5-3-2-4-6-7)11-12-9(13)10(14)15;/h2-6H,1H3,(H,14,15);
InChI key:InChIKey=LVMBSTVHRIFVBN-UHFFFAOYSA-N
SMILES:CN1C(=NN=C1C(O)=O)C2=CC=CC=C2.[Li]
Synonyms:
  • 4H-1,2,4-Triazole-3-carboxylic acid, 4-methyl-5-phenyl-, lithium salt (1:1)
Found 1 products.