CymitQuimica logo

CAS 1803592-68-8

:

3-Furancarboxylic acid, 5-(aminomethyl)-2-methyl-, hydrochloride (1:1)

Description:
3-Furancarboxylic acid, 5-(aminomethyl)-2-methyl-, hydrochloride (1:1) is a chemical compound characterized by its furan ring structure, which is a five-membered aromatic ring containing one oxygen atom. This compound features a carboxylic acid functional group and an amino group, indicating its potential for various chemical reactivity and biological activity. The presence of the hydrochloride indicates that it is in a salt form, which often enhances solubility in water and may influence its pharmacological properties. The compound's molecular structure suggests it may have applications in medicinal chemistry, particularly in the development of pharmaceuticals or agrochemicals. Its specific properties, such as melting point, solubility, and reactivity, would depend on the interactions of the functional groups present. Additionally, the compound's CAS number, 1803592-68-8, allows for precise identification and retrieval of information in chemical databases, facilitating research and development efforts. Overall, this compound represents a unique combination of features that may be of interest in various scientific fields.
Formula:C7H9NO3·ClH
InChI:InChI=1S/C7H9NO3.ClH/c1-4-6(7(9)10)2-5(3-8)11-4;/h2H,3,8H2,1H3,(H,9,10);1H
InChI key:InChIKey=QYYLGEAAPQHFNE-UHFFFAOYSA-N
SMILES:C(O)(=O)C1=C(C)OC(CN)=C1.Cl
Synonyms:
  • 3-Furancarboxylic acid, 5-(aminomethyl)-2-methyl-, hydrochloride (1:1)
Found 1 products.