CymitQuimica logo

CAS 1803604-20-7

:

4-(Aminosulfonyl)-1-methyl-α-oxo-1H-pyrrole-2-acetamide

Description:
4-(Aminosulfonyl)-1-methyl-α-oxo-1H-pyrrole-2-acetamide is a chemical compound characterized by its unique structural features, which include a pyrrole ring substituted with an aminosulfonyl group and an acetamide moiety. This compound typically exhibits properties associated with both heterocyclic compounds and sulfonamides, such as potential solubility in polar solvents and the ability to form hydrogen bonds due to the presence of functional groups like the amide and sulfonamide. The α-oxo group contributes to its reactivity, potentially allowing for various chemical transformations. Additionally, the presence of the methyl group on the pyrrole ring may influence its electronic properties and steric hindrance, affecting its biological activity. Compounds of this nature are often studied for their pharmacological potential, particularly in medicinal chemistry, where modifications to the core structure can lead to enhanced efficacy or selectivity in biological applications. Overall, this compound represents a class of molecules with diverse applications in drug development and chemical synthesis.
Formula:C7H9N3O4S
InChI:InChI=1S/C7H9N3O4S/c1-10-3-4(15(9,13)14)2-5(10)6(11)7(8)12/h2-3H,1H3,(H2,8,12)(H2,9,13,14)
InChI key:InChIKey=SXPKWTZNLULIRE-UHFFFAOYSA-N
SMILES:C(C(N)=O)(=O)C1=CC(S(N)(=O)=O)=CN1C
Synonyms:
  • 1H-Pyrrole-2-acetamide, 4-(aminosulfonyl)-1-methyl-α-oxo-
  • 4-(Aminosulfonyl)-1-methyl-α-oxo-1H-pyrrole-2-acetamide
Found 1 products.